C23H32F3NO3 — CID 91740095
octyl 2-cyclohexyl-2-[(2,3,4-trifluorobenzoyl)amino]acetate (PubChem CID 91740095) has the molecular formula C23H32F3NO3 and a molecular weight of 427.51 g/mol. Its IUPAC name is octyl 2-cyclohexyl-2-[(2,3,4-trifluorobenzoyl)amino]acetate.
| Compound Name | octyl 2-cyclohexyl-2-[(2,3,4-trifluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 91740095 |
| Molecular Formula | C23H32F3NO3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | octyl 2-cyclohexyl-2-[(2,3,4-trifluorobenzoyl)amino]acetate |
| SMILES | CCCCCCCCOC(=O)C(NC(=O)c1ccc(F)c(F)c1F)C1CCCCC1 |
| InChI | InChI=1S/C23H32F3NO3/c1-2-3-4-5-6-10-15-30-23(29)21(16-11-8-7-9-12-16)27-22(28)17-13-14-18(24)20(26)19(17)25/h13-14,16,21H,2-12,15H2,1H3,(H,27,28) |
| InChIKey | FYALDWWLNRZDES-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|