C27H46O2Si — CID 91740201
(3R,5S,8R,9S,10S,13S,14S)-3-(1-tert-butylsilolan-1-yl)oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 91740201) has the molecular formula C27H46O2Si and a molecular weight of 430.75 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S)-3-(1-tert-butylsilolan-1-yl)oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S)-3-(1-tert-butylsilolan-1-yl)oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 91740201 |
| Molecular Formula | C27H46O2Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S)-3-(1-tert-butylsilolan-1-yl)oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)(C)[Si]1(O[C@@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]43)C2)CCCC1 |
| InChI | InChI=1S/C27H46O2Si/c1-25(2,3)30(16-6-7-17-30)29-20-12-14-26(4)19(18-20)8-9-21-22-10-11-24(28)27(22,5)15-13-23(21)26/h19-23H,6-18H2,1-5H3/t19-,20+,21-,22-,23-,26-,27-/m0/s1 |
| InChIKey | BSVQVMAFWBNYSZ-PTBUDQQISA-N |
| XLogP | 7.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|