C16H19N3O3 — CID 91741665
2-methoxy-1-N,1-N,5-trimethyl-4-N-(4-nitrophenyl)benzene-1,4-diamine (PubChem CID 91741665) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-methoxy-1-N,1-N,5-trimethyl-4-N-(4-nitrophenyl)benzene-1,4-diamine.
| Compound Name | 2-methoxy-1-N,1-N,5-trimethyl-4-N-(4-nitrophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 91741665 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-methoxy-1-N,1-N,5-trimethyl-4-N-(4-nitrophenyl)benzene-1,4-diamine |
| SMILES | COc1cc(Nc2ccc([N+](=O)[O-])cc2)c(C)cc1N(C)C |
| InChI | InChI=1S/C16H19N3O3/c1-11-9-15(18(2)3)16(22-4)10-14(11)17-12-5-7-13(8-6-12)19(20)21/h5-10,17H,1-4H3 |
| InChIKey | PVRQGXWBDDECOZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|