C28H31N5O5S — CID 91743355
ethyl 2-(N-[2-[4-(4-phenyldiazenylphenyl)sulfonylpiperazin-1-yl]acetyl]anilino)acetate (PubChem CID 91743355) has the molecular formula C28H31N5O5S and a molecular weight of 549.65 g/mol. Its IUPAC name is ethyl 2-(N-[2-[4-(4-phenyldiazenylphenyl)sulfonylpiperazin-1-yl]acetyl]anilino)acetate.
| Compound Name | ethyl 2-(N-[2-[4-(4-phenyldiazenylphenyl)sulfonylpiperazin-1-yl]acetyl]anilino)acetate |
|---|---|
| PubChem CID | 91743355 |
| Molecular Formula | C28H31N5O5S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | ethyl 2-(N-[2-[4-(4-phenyldiazenylphenyl)sulfonylpiperazin-1-yl]acetyl]anilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)CN1CCN(S(=O)(=O)c2ccc(/N=N/c3ccccc3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H31N5O5S/c1-2-38-28(35)22-33(25-11-7-4-8-12-25)27(34)21-31-17-19-32(20-18-31)39(36,37)26-15-13-24(14-16-26)30-29-23-9-5-3-6-10-23/h3-16H,2,17-22H2,1H3/b30-29+ |
| InChIKey | XRFOZUJKFQETEX-QVIHXGFCSA-N |
| XLogP | 4.00 |
| TPSA | 111.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|