C31H57NO4Si2 — CID 91747270
methyl 4-[(3R,5R)-10,13-dimethyl-3-trimethylsilyloxy-12-trimethylsilyloxyimino-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91747270) has the molecular formula C31H57NO4Si2 and a molecular weight of 563.97 g/mol. Its IUPAC name is methyl 4-[(3R,5R)-10,13-dimethyl-3-trimethylsilyloxy-12-trimethylsilyloxyimino-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[(3R,5R)-10,13-dimethyl-3-trimethylsilyloxy-12-trimethylsilyloxyimino-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91747270 |
| Molecular Formula | C31H57NO4Si2 |
| Molecular Weight | 563.97 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | methyl 4-[(3R,5R)-10,13-dimethyl-3-trimethylsilyloxy-12-trimethylsilyloxyimino-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3CC[C@@H]4C[C@H](O[Si](C)(C)C)CCC4(C)C3CC(=NO[Si](C)(C)C)C12C |
| InChI | InChI=1S/C31H57NO4Si2/c1-21(11-16-29(33)34-4)25-14-15-26-24-13-12-22-19-23(35-37(5,6)7)17-18-30(22,2)27(24)20-28(31(25,26)3)32-36-38(8,9)10/h21-27H,11-20H2,1-10H3/t21?,22-,23-,24?,25?,26?,27?,30?,31?/m1/s1 |
| InChIKey | BVZSXWZRUJSAMP-QBEWLJAKSA-N |
| XLogP | 8.27 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.97 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|