C31H56N2O4Si2 — CID 91747265
methyl 4-[(5R)-10,13-dimethyl-3,12-bis(trimethylsilyloxyimino)-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91747265) has the molecular formula C31H56N2O4Si2 and a molecular weight of 576.97 g/mol. Its IUPAC name is methyl 4-[(5R)-10,13-dimethyl-3,12-bis(trimethylsilyloxyimino)-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[(5R)-10,13-dimethyl-3,12-bis(trimethylsilyloxyimino)-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91747265 |
| Molecular Formula | C31H56N2O4Si2 |
| Molecular Weight | 576.97 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | methyl 4-[(5R)-10,13-dimethyl-3,12-bis(trimethylsilyloxyimino)-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3CC[C@@H]4CC(=NO[Si](C)(C)C)CCC4(C)C3CC(=NO[Si](C)(C)C)C12C |
| InChI | InChI=1S/C31H56N2O4Si2/c1-21(11-16-29(34)35-4)25-14-15-26-24-13-12-22-19-23(32-36-38(5,6)7)17-18-30(22,2)27(24)20-28(31(25,26)3)33-37-39(8,9)10/h21-22,24-27H,11-20H2,1-10H3/t21?,22-,24?,25?,26?,27?,30?,31?/m1/s1 |
| InChIKey | VRCDGKRYZBFSLU-ZMPVYTCUSA-N |
| XLogP | 8.26 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.97 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|