C15H22O — CID 91747443
3,7,10,10-tetramethyl-11-oxatricyclo[7.2.1.02,6]dodeca-2,7-diene (PubChem CID 91747443) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 3,7,10,10-tetramethyl-11-oxatricyclo[7.2.1.02,6]dodeca-2,7-diene.
| Compound Name | 3,7,10,10-tetramethyl-11-oxatricyclo[7.2.1.02,6]dodeca-2,7-diene |
|---|---|
| PubChem CID | 91747443 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 3,7,10,10-tetramethyl-11-oxatricyclo[7.2.1.02,6]dodeca-2,7-diene |
| SMILES | CC1=CC2CC(OC2(C)C)C2=C(C)CCC12 |
| InChI | InChI=1S/C15H22O/c1-9-5-6-12-10(2)7-11-8-13(14(9)12)16-15(11,3)4/h7,11-13H,5-6,8H2,1-4H3 |
| InChIKey | SVGQUABWMVWDON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|