C21H20F5NO4 — CID 91747601
(2,3,4,5,6-pentafluorophenyl)methyl 2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate (PubChem CID 91747601) has the molecular formula C21H20F5NO4 and a molecular weight of 445.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 91747601 |
| Molecular Formula | C21H20F5NO4 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate |
| SMILES | COCC(=O)N(c1c(C)cccc1C)C(C)C(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H20F5NO4/c1-10-6-5-7-11(2)20(10)27(14(28)9-30-4)12(3)21(29)31-8-13-15(22)17(24)19(26)18(25)16(13)23/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | VHXOTQFOLFXRTR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|