C16H26 — CID 91748558
5-tert-butyl-3,8-dimethyl-1,3a,4,7,8,8a-hexahydroazulene (PubChem CID 91748558) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 5-tert-butyl-3,8-dimethyl-1,3a,4,7,8,8a-hexahydroazulene.
| Compound Name | 5-tert-butyl-3,8-dimethyl-1,3a,4,7,8,8a-hexahydroazulene |
|---|---|
| PubChem CID | 91748558 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 5-tert-butyl-3,8-dimethyl-1,3a,4,7,8,8a-hexahydroazulene |
| SMILES | CC1=CCC2C(C)CC=C(C(C)(C)C)CC12 |
| InChI | InChI=1S/C16H26/c1-11-6-8-13(16(3,4)5)10-15-12(2)7-9-14(11)15/h7-8,11,14-15H,6,9-10H2,1-5H3 |
| InChIKey | QAUZVGPDSDIYTH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|