About 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene
2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene (PubChem CID 91748660) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene |
| PubChem CID | 91748660 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene |
| SMILES | COC1=CC2CCC1C2(C)C |
| InChI | InChI=1S/C10H16O/c1-10(2)7-4-5-8(10)9(6-7)11-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | APTDFJFBANRDGF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene?
The IUPAC name of 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene (CID 91748660) is 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene is COC1=CC2CCC1C2(C)C.
What is the InChIKey of 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene?
The InChIKey is APTDFJFBANRDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-10(2)7-4-5-8(10)9(6-7)11-3/h6-8H,4-5H2,1-3H3.
What are the key properties of 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene?
2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene has a molecular weight of 152.24 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-7,7-dimethylbicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 91748660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).