C13H8F6O6 — CID 91749154
[4-[2-methoxy-2-oxo-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 91749154) has the molecular formula C13H8F6O6 and a molecular weight of 374.19 g/mol. Its IUPAC name is [4-[2-methoxy-2-oxo-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[2-methoxy-2-oxo-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91749154 |
| Molecular Formula | C13H8F6O6 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | [4-[2-methoxy-2-oxo-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | COC(=O)C(OC(=O)C(F)(F)F)c1ccc(OC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H8F6O6/c1-23-9(20)8(25-11(22)13(17,18)19)6-2-4-7(5-3-6)24-10(21)12(14,15)16/h2-5,8H,1H3 |
| InChIKey | UAMATDKDQXDBOA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|