C15H22O2 — CID 91750064
(1aR,5S,7bR)-5-hydroxy-3,3,5,7b-tetramethyl-1a,2,6,7-tetrahydro-1H-cyclopropa[a]naphthalen-4-one (PubChem CID 91750064) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1aR,5S,7bR)-5-hydroxy-3,3,5,7b-tetramethyl-1a,2,6,7-tetrahydro-1H-cyclopropa[a]naphthalen-4-one.
| Compound Name | (1aR,5S,7bR)-5-hydroxy-3,3,5,7b-tetramethyl-1a,2,6,7-tetrahydro-1H-cyclopropa[a]naphthalen-4-one |
|---|---|
| PubChem CID | 91750064 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1aR,5S,7bR)-5-hydroxy-3,3,5,7b-tetramethyl-1a,2,6,7-tetrahydro-1H-cyclopropa[a]naphthalen-4-one |
| SMILES | CC1(C)C[C@H]2C[C@@]2(C)C2=C1C(=O)[C@@](C)(O)CC2 |
| InChI | InChI=1S/C15H22O2/c1-13(2)7-9-8-14(9,3)10-5-6-15(4,17)12(16)11(10)13/h9,17H,5-8H2,1-4H3/t9-,14+,15-/m0/s1 |
| InChIKey | QDNBEGKPBFOPJU-AMFBXLIHSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |