C15H24O2 — CID 91750067
(2S,6R,8E)-2,6,10,10-tetramethylcycloundec-8-ene-1,5-dione (PubChem CID 91750067) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2S,6R,8E)-2,6,10,10-tetramethylcycloundec-8-ene-1,5-dione.
| Compound Name | (2S,6R,8E)-2,6,10,10-tetramethylcycloundec-8-ene-1,5-dione |
|---|---|
| PubChem CID | 91750067 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2S,6R,8E)-2,6,10,10-tetramethylcycloundec-8-ene-1,5-dione |
| SMILES | C[C@@H]1C/C=C/C(C)(C)CC(=O)[C@@H](C)CCC1=O |
| InChI | InChI=1S/C15H24O2/c1-11-6-5-9-15(3,4)10-14(17)12(2)7-8-13(11)16/h5,9,11-12H,6-8,10H2,1-4H3/b9-5+/t11-,12+/m1/s1 |
| InChIKey | MSVVNYKZJZHIJV-UEUGTDCTSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|