C37H70O5Si3 — CID 91750775
methyl 6-[(5R,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate (PubChem CID 91750775) has the molecular formula C37H70O5Si3 and a molecular weight of 679.22 g/mol. Its IUPAC name is methyl 6-[(5R,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate.
| Compound Name | methyl 6-[(5R,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate |
|---|---|
| PubChem CID | 91750775 |
| Molecular Formula | C37H70O5Si3 |
| Molecular Weight | 679.22 g/mol |
| Exact Mass | 678.45 |
| IUPAC Name | methyl 6-[(5R,7R,10R,12S,13R,17R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoate |
| SMILES | COC(=O)C(C)CCCC(C)[C@H]1CCC2C3C(O[Si](C)(C)C)C[C@@H]4C=C(O[Si](C)(C)C)CC[C@]4(C)C3C[C@H](O[Si](C)(C)C)[C@@]21C |
| InChI | InChI=1S/C37H70O5Si3/c1-25(16-15-17-26(2)35(38)39-5)29-18-19-30-34-31(24-33(37(29,30)4)42-45(12,13)14)36(3)21-20-28(40-43(6,7)8)22-27(36)23-32(34)41-44(9,10)11/h22,25-27,29-34H,15-21,23-24H2,1-14H3/t25?,26?,27-,29+,30?,31?,32?,33-,34?,36-,37+/m0/s1 |
| InChIKey | VIVBCUNEPIJING-GEXYEWHUSA-N |
| XLogP | 10.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.22 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|