C18H30O8S2 — CID 91751030
[(2S,3R,4R,5S)-3,4,5-triacetyloxy-6,6-bis(ethylsulfanyl)hexan-2-yl] acetate (PubChem CID 91751030) has the molecular formula C18H30O8S2 and a molecular weight of 438.56 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-3,4,5-triacetyloxy-6,6-bis(ethylsulfanyl)hexan-2-yl] acetate.
| Compound Name | [(2S,3R,4R,5S)-3,4,5-triacetyloxy-6,6-bis(ethylsulfanyl)hexan-2-yl] acetate |
|---|---|
| PubChem CID | 91751030 |
| Molecular Formula | C18H30O8S2 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [(2S,3R,4R,5S)-3,4,5-triacetyloxy-6,6-bis(ethylsulfanyl)hexan-2-yl] acetate |
| SMILES | CCSC(SCC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C18H30O8S2/c1-8-27-18(28-9-2)17(26-14(7)22)16(25-13(6)21)15(24-12(5)20)10(3)23-11(4)19/h10,15-18H,8-9H2,1-7H3/t10-,15+,16+,17-/m0/s1 |
| InChIKey | IGZAPMUTZWRKTE-ZMPFYLFPSA-N |
| XLogP | 2.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|