C20H34O7 — CID 91751147
1-[2,2-dimethyl-3-[2-(2-prop-2-enoyloxypropoxy)propoxy]propoxy]propan-2-yl prop-2-enoate (PubChem CID 91751147) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-[2-(2-prop-2-enoyloxypropoxy)propoxy]propoxy]propan-2-yl prop-2-enoate.
| Compound Name | 1-[2,2-dimethyl-3-[2-(2-prop-2-enoyloxypropoxy)propoxy]propoxy]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 91751147 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1-[2,2-dimethyl-3-[2-(2-prop-2-enoyloxypropoxy)propoxy]propoxy]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COCC(C)(C)COCC(C)OCC(C)OC(=O)C=C |
| InChI | InChI=1S/C20H34O7/c1-8-18(21)26-16(4)11-24-14-20(6,7)13-23-10-15(3)25-12-17(5)27-19(22)9-2/h8-9,15-17H,1-2,10-14H2,3-7H3 |
| InChIKey | GVAKVLUFUQSBNI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|