C16H31NO4Si — CID 91751443
2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 91751443) has the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. Its IUPAC name is 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91751443 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-(2-methylpropyl) (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)N1CCC[C@H]1C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO4Si/c1-12(2)11-20-15(19)17-10-8-9-13(17)14(18)21-22(6,7)16(3,4)5/h12-13H,8-11H2,1-7H3/t13-/m0/s1 |
| InChIKey | SXOFCRXOJZTZKC-ZDUSSCGKSA-N |
| XLogP | 3.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|