C21H48O7Si4 — CID 91752384
trimethylsilyl 6-propoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 91752384) has the molecular formula C21H48O7Si4 and a molecular weight of 524.95 g/mol. Its IUPAC name is trimethylsilyl 6-propoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | trimethylsilyl 6-propoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91752384 |
| Molecular Formula | C21H48O7Si4 |
| Molecular Weight | 524.95 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | trimethylsilyl 6-propoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | CCCOC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C21H48O7Si4/c1-14-15-23-21-19(27-31(8,9)10)17(26-30(5,6)7)16(25-29(2,3)4)18(24-21)20(22)28-32(11,12)13/h16-19,21H,14-15H2,1-13H3 |
| InChIKey | RGPKXUCUWGYNNC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.95 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|