C22H50O7Si4 — CID 91752392
trimethylsilyl 6-[(2R)-butan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 91752392) has the molecular formula C22H50O7Si4 and a molecular weight of 538.98 g/mol. Its IUPAC name is trimethylsilyl 6-[(2R)-butan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | trimethylsilyl 6-[(2R)-butan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91752392 |
| Molecular Formula | C22H50O7Si4 |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | trimethylsilyl 6-[(2R)-butan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | CC[C@@H](C)OC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C22H50O7Si4/c1-15-16(2)24-22-20(28-32(9,10)11)18(27-31(6,7)8)17(26-30(3,4)5)19(25-22)21(23)29-33(12,13)14/h16-20,22H,15H2,1-14H3/t16-,17?,18?,19?,20?,22?/m1/s1 |
| InChIKey | BYQDUSVVYSRQEK-DXYSLGBVSA-N |
| XLogP | 5.56 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|