About [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate
[tert-butyl(dimethyl)silyl] 2-hydroxybutanoate (PubChem CID 91752568) has the molecular formula C10H22O3Si
and a molecular weight of 218.37 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate |
| PubChem CID | 91752568 |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H22O3Si/c1-7-8(11)9(12)13-14(5,6)10(2,3)4/h8,11H,7H2,1-6H3 |
| InChIKey | QWWUTNLRKPSPKU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate?
The IUPAC name of [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate (CID 91752568) is [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate is CCC(O)C(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate?
The InChIKey is QWWUTNLRKPSPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3Si/c1-7-8(11)9(12)13-14(5,6)10(2,3)4/h8,11H,7H2,1-6H3.
What are the key properties of [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate?
[tert-butyl(dimethyl)silyl] 2-hydroxybutanoate has a molecular weight of 218.37 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] 2-hydroxybutanoate is sourced from PubChem (CID 91752568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).