C24H43NO5Si2 — CID 91752664
[tert-butyl(dimethyl)silyl] 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(ethoxycarbonylamino)propanoate (PubChem CID 91752664) has the molecular formula C24H43NO5Si2 and a molecular weight of 481.78 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(ethoxycarbonylamino)propanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(ethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 91752664 |
| Molecular Formula | C24H43NO5Si2 |
| Molecular Weight | 481.78 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(ethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)NC(Cc1ccc(O[Si](C)(C)C(C)(C)C)cc1)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43NO5Si2/c1-12-28-22(27)25-20(21(26)30-32(10,11)24(5,6)7)17-18-13-15-19(16-14-18)29-31(8,9)23(2,3)4/h13-16,20H,12,17H2,1-11H3,(H,25,27) |
| InChIKey | USKDFOGPKGHEFX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|