C14H15ClO4 — CID 91752670
(8S)-8-[2-(3-chlorophenyl)ethyl]-1,4-dioxocane-2,5-dione (PubChem CID 91752670) has the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. Its IUPAC name is (8S)-8-[2-(3-chlorophenyl)ethyl]-1,4-dioxocane-2,5-dione.
| Compound Name | (8S)-8-[2-(3-chlorophenyl)ethyl]-1,4-dioxocane-2,5-dione |
|---|---|
| PubChem CID | 91752670 |
| Molecular Formula | C14H15ClO4 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (8S)-8-[2-(3-chlorophenyl)ethyl]-1,4-dioxocane-2,5-dione |
| SMILES | O=C1CC[C@H](CCc2cccc(Cl)c2)OC(=O)CO1 |
| InChI | InChI=1S/C14H15ClO4/c15-11-3-1-2-10(8-11)4-5-12-6-7-13(16)18-9-14(17)19-12/h1-3,8,12H,4-7,9H2/t12-/m0/s1 |
| InChIKey | TWKXIKOLHGONCZ-LBPRGKRZSA-N |
| XLogP | 2.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |