C12H4F14N2O2 — CID 91752924
2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)-N-pyrrol-1-ylbutanamide (PubChem CID 91752924) has the molecular formula C12H4F14N2O2 and a molecular weight of 474.15 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)-N-pyrrol-1-ylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)-N-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 91752924 |
| Molecular Formula | C12H4F14N2O2 |
| Molecular Weight | 474.15 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)-N-pyrrol-1-ylbutanamide |
| SMILES | O=C(N(C(=O)C(F)(F)C(F)(F)C(F)(F)F)n1cccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4F14N2O2/c13-7(14,9(17,18)11(21,22)23)5(29)28(27-3-1-2-4-27)6(30)8(15,16)10(19,20)12(24,25)26/h1-4H |
| InChIKey | ACNNMXKAXMYNEL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.15 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|