C18H17N3O2 — CID 9175311
N-[(Z)-1-[4-(cyanomethoxy)phenyl]ethylideneamino]-4-methylbenzamide (PubChem CID 9175311) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[(Z)-1-[4-(cyanomethoxy)phenyl]ethylideneamino]-4-methylbenzamide.
| Compound Name | N-[(Z)-1-[4-(cyanomethoxy)phenyl]ethylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 9175311 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-[(Z)-1-[4-(cyanomethoxy)phenyl]ethylideneamino]-4-methylbenzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(C)cc1)c1ccc(OCC#N)cc1 |
| InChI | InChI=1S/C18H17N3O2/c1-13-3-5-16(6-4-13)18(22)21-20-14(2)15-7-9-17(10-8-15)23-12-11-19/h3-10H,12H2,1-2H3,(H,21,22)/b20-14- |
| InChIKey | GCEFQGLAEXZGEJ-ZHZULCJRSA-N |
| XLogP | 3.05 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|