3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid

C10H6Cl2O3S — CID 91756107

IUPAC3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid
SMILESCOc1ccc(Cl)c2sc(C(=O)O)c(Cl)c12
InChIInChI=1S/C10H6Cl2O3S/c1-15-5-3-2-4(11)8-6(5)7(12)9(16-8)10(13)14/h2-3H,1H3,(H,13,14)
InChIKeyPQWZVGDYPJEJII-UHFFFAOYSA-N
MW277.13 g/mol
LogP3.91
Rot. Bonds2

About 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid

3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid (PubChem CID 91756107) has the molecular formula C10H6Cl2O3S and a molecular weight of 277.13 g/mol. Its IUPAC name is 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid.

Molecular Properties

Compound Name3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid
PubChem CID91756107
Molecular FormulaC10H6Cl2O3S
Molecular Weight277.13 g/mol
Exact Mass275.94
IUPAC Name3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid
SMILESCOc1ccc(Cl)c2sc(C(=O)O)c(Cl)c12
InChIInChI=1S/C10H6Cl2O3S/c1-15-5-3-2-4(11)8-6(5)7(12)9(16-8)10(13)14/h2-3H,1H3,(H,13,14)
InChIKeyPQWZVGDYPJEJII-UHFFFAOYSA-N
XLogP3.91
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.13
LogP ≤ 53.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid (CID 91756107) is 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid is COc1ccc(Cl)c2sc(C(=O)O)c(Cl)c12.
What is the InChIKey of 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid?
The InChIKey is PQWZVGDYPJEJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2O3S/c1-15-5-3-2-4(11)8-6(5)7(12)9(16-8)10(13)14/h2-3H,1H3,(H,13,14).
What are the key properties of 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid?
3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid has a molecular weight of 277.13 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 91756107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).