C10H6Cl2O3S — CID 91756107
3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid (PubChem CID 91756107) has the molecular formula C10H6Cl2O3S and a molecular weight of 277.13 g/mol. Its IUPAC name is 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 91756107 |
| Molecular Formula | C10H6Cl2O3S |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 275.94 |
| IUPAC Name | 3,7-dichloro-4-methoxy-1-benzothiophene-2-carboxylic acid |
| SMILES | COc1ccc(Cl)c2sc(C(=O)O)c(Cl)c12 |
| InChI | InChI=1S/C10H6Cl2O3S/c1-15-5-3-2-4(11)8-6(5)7(12)9(16-8)10(13)14/h2-3H,1H3,(H,13,14) |
| InChIKey | PQWZVGDYPJEJII-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |