C12H7Cl2NOS — CID 91756451
3,4-dichloro-8-methoxythieno[3,2-c]quinoline (PubChem CID 91756451) has the molecular formula C12H7Cl2NOS and a molecular weight of 284.17 g/mol. Its IUPAC name is 3,4-dichloro-8-methoxythieno[3,2-c]quinoline.
| Compound Name | 3,4-dichloro-8-methoxythieno[3,2-c]quinoline |
|---|---|
| PubChem CID | 91756451 |
| Molecular Formula | C12H7Cl2NOS |
| Molecular Weight | 284.17 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | 3,4-dichloro-8-methoxythieno[3,2-c]quinoline |
| SMILES | COc1ccc2nc(Cl)c3c(Cl)csc3c2c1 |
| InChI | InChI=1S/C12H7Cl2NOS/c1-16-6-2-3-9-7(4-6)11-10(12(14)15-9)8(13)5-17-11/h2-5H,1H3 |
| InChIKey | MJNHXPMCOGZFQN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.17 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|