C17H25N3O4S2 — CID 91757767
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(2,4-dioxocyclopentyl)sulfanylethyl]pentanamide (PubChem CID 91757767) has the molecular formula C17H25N3O4S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(2,4-dioxocyclopentyl)sulfanylethyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(2,4-dioxocyclopentyl)sulfanylethyl]pentanamide |
|---|---|
| PubChem CID | 91757767 |
| Molecular Formula | C17H25N3O4S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(2,4-dioxocyclopentyl)sulfanylethyl]pentanamide |
| SMILES | O=C1CC(=O)C(SCCNC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)C1 |
| InChI | InChI=1S/C17H25N3O4S2/c21-10-7-12(22)14(8-10)25-6-5-18-15(23)4-2-1-3-13-16-11(9-26-13)19-17(24)20-16/h11,13-14,16H,1-9H2,(H,18,23)(H2,19,20,24)/t11-,13-,14?,16-/m0/s1 |
| InChIKey | SZMCPIYEFJEIRR-GOCDRHMWSA-N |
| XLogP | 0.86 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|