C18H28O2 — CID 91758452
(4S,4aR)-4a,8,8-trimethyl-3-methylidene-4-(3-oxobutyl)-5,6,7,8a-tetrahydro-4H-naphthalen-1-one (PubChem CID 91758452) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (4S,4aR)-4a,8,8-trimethyl-3-methylidene-4-(3-oxobutyl)-5,6,7,8a-tetrahydro-4H-naphthalen-1-one.
| Compound Name | (4S,4aR)-4a,8,8-trimethyl-3-methylidene-4-(3-oxobutyl)-5,6,7,8a-tetrahydro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 91758452 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (4S,4aR)-4a,8,8-trimethyl-3-methylidene-4-(3-oxobutyl)-5,6,7,8a-tetrahydro-4H-naphthalen-1-one |
| SMILES | C=C1CC(=O)C2C(C)(C)CCC[C@]2(C)[C@H]1CCC(C)=O |
| InChI | InChI=1S/C18H28O2/c1-12-11-15(20)16-17(3,4)9-6-10-18(16,5)14(12)8-7-13(2)19/h14,16H,1,6-11H2,2-5H3/t14-,16?,18+/m0/s1 |
| InChIKey | DYMNPQGMRMZYOM-GVVCSIHDSA-N |
| XLogP | 4.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|