C15H20FNO3 — CID 91760239
4-fluoro-3-hydroxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylbenzamide (PubChem CID 91760239) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-fluoro-3-hydroxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylbenzamide.
| Compound Name | 4-fluoro-3-hydroxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 91760239 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-fluoro-3-hydroxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]-N-methylbenzamide |
| SMILES | CN(CC1(CO)CCCC1)C(=O)c1ccc(F)c(O)c1 |
| InChI | InChI=1S/C15H20FNO3/c1-17(9-15(10-18)6-2-3-7-15)14(20)11-4-5-12(16)13(19)8-11/h4-5,8,18-19H,2-3,6-7,9-10H2,1H3 |
| InChIKey | QMSWNNZEGDUMGI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |