C14H18N4O4S2 — CID 91762643
5-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]thiophene-3-carboxamide (PubChem CID 91762643) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]thiophene-3-carboxamide.
| Compound Name | 5-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 91762643 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 5-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]thiophene-3-carboxamide |
| SMILES | CC(O)c1cc2n(n1)CCCN(S(=O)(=O)c1cc(C(N)=O)cs1)C2 |
| InChI | InChI=1S/C14H18N4O4S2/c1-9(19)12-6-11-7-17(3-2-4-18(11)16-12)24(21,22)13-5-10(8-23-13)14(15)20/h5-6,8-9,19H,2-4,7H2,1H3,(H2,15,20) |
| InChIKey | HWUSAJUGZQRTHB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |