C17H22N4O4S — CID 91785112
3-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]-N-methylbenzamide (PubChem CID 91785112) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]-N-methylbenzamide.
| Compound Name | 3-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 91785112 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[[2-(1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]sulfonyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(S(=O)(=O)N2CCCn3nc(C(C)O)cc3C2)c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-12(22)16-10-14-11-20(7-4-8-21(14)19-16)26(24,25)15-6-3-5-13(9-15)17(23)18-2/h3,5-6,9-10,12,22H,4,7-8,11H2,1-2H3,(H,18,23) |
| InChIKey | CULSLBKBSVJOLE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |