C19H20ClN3O4S — CID 55835241
2-chloro-N-methyl-5-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzamide (PubChem CID 55835241) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzamide.
| Compound Name | 2-chloro-N-methyl-5-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 55835241 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-chloro-N-methyl-5-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzamide |
| SMILES | CNC(=O)c1cc(NC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)ccc1Cl |
| InChI | InChI=1S/C19H20ClN3O4S/c1-21-19(25)16-12-14(7-8-17(16)20)22-18(24)13-5-4-6-15(11-13)28(26,27)23-9-2-3-10-23/h4-8,11-12H,2-3,9-10H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | VKTJRJCKWNSPOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |