C19H22N4O2S — CID 9176380
N-[3-[(Z)-N-[(4-methoxyphenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]phenyl]acetamide (PubChem CID 9176380) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[3-[(Z)-N-[(4-methoxyphenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]phenyl]acetamide.
| Compound Name | N-[3-[(Z)-N-[(4-methoxyphenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9176380 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[3-[(Z)-N-[(4-methoxyphenyl)methylcarbamothioylamino]-C-methylcarbonimidoyl]phenyl]acetamide |
| SMILES | COc1ccc(CNC(=S)N/N=C(/C)c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13(16-5-4-6-17(11-16)21-14(2)24)22-23-19(26)20-12-15-7-9-18(25-3)10-8-15/h4-11H,12H2,1-3H3,(H,21,24)(H2,20,23,26)/b22-13- |
| InChIKey | MRPMXIKMZWRMND-XKZIYDEJSA-N |
| XLogP | 3.04 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|