C16H18N2O2S — CID 91764411
N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-2-pyridin-3-ylacetamide (PubChem CID 91764411) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-2-pyridin-3-ylacetamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 91764411 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-thiophen-2-ylmethyl]-2-pyridin-3-ylacetamide |
| SMILES | O=C(Cc1cccnc1)NC(c1cccs1)C1CC(O)C1 |
| InChI | InChI=1S/C16H18N2O2S/c19-13-8-12(9-13)16(14-4-2-6-21-14)18-15(20)7-11-3-1-5-17-10-11/h1-6,10,12-13,16,19H,7-9H2,(H,18,20) |
| InChIKey | LWIJPFIHSZELPP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |