C20H20N2O2S — CID 91764754
N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]-2-thiophen-2-ylacetamide (PubChem CID 91764754) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 91764754 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-quinolin-3-ylmethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NC(c1cnc2ccccc2c1)C1CC(O)C1 |
| InChI | InChI=1S/C20H20N2O2S/c23-16-9-14(10-16)20(22-19(24)11-17-5-3-7-25-17)15-8-13-4-1-2-6-18(13)21-12-15/h1-8,12,14,16,20,23H,9-11H2,(H,22,24) |
| InChIKey | HBCZHBMZEONBGX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |