C19H24N2OS2 — CID 91791309
3-[(1,4-dithiepan-6-ylamino)-quinolin-3-ylmethyl]cyclobutan-1-ol (PubChem CID 91791309) has the molecular formula C19H24N2OS2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 3-[(1,4-dithiepan-6-ylamino)-quinolin-3-ylmethyl]cyclobutan-1-ol.
| Compound Name | 3-[(1,4-dithiepan-6-ylamino)-quinolin-3-ylmethyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 91791309 |
| Molecular Formula | C19H24N2OS2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-[(1,4-dithiepan-6-ylamino)-quinolin-3-ylmethyl]cyclobutan-1-ol |
| SMILES | OC1CC(C(NC2CSCCSC2)c2cnc3ccccc3c2)C1 |
| InChI | InChI=1S/C19H24N2OS2/c22-17-8-14(9-17)19(21-16-11-23-5-6-24-12-16)15-7-13-3-1-2-4-18(13)20-10-15/h1-4,7,10,14,16-17,19,21-22H,5-6,8-9,11-12H2 |
| InChIKey | DRLHKJJTGNIXID-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |