C17H20N4OS — CID 91765313
3-(1H-indol-3-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]propanamide (PubChem CID 91765313) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]propanamide.
| Compound Name | 3-(1H-indol-3-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 91765313 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-(1H-indol-3-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]propanamide |
| SMILES | CSc1ncc(CNC(=O)CCc2c[nH]c3ccccc23)n1C |
| InChI | InChI=1S/C17H20N4OS/c1-21-13(11-20-17(21)23-2)10-19-16(22)8-7-12-9-18-15-6-4-3-5-14(12)15/h3-6,9,11,18H,7-8,10H2,1-2H3,(H,19,22) |
| InChIKey | GPMVMGGTVWWZEV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |