C19H26N4O2 — CID 91769556
N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-phenoxybutanamide (PubChem CID 91769556) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-phenoxybutanamide.
| Compound Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 91769556 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)NCc1nncn1C1CCCCC1 |
| InChI | InChI=1S/C19H26N4O2/c24-19(12-7-13-25-17-10-5-2-6-11-17)20-14-18-22-21-15-23(18)16-8-3-1-4-9-16/h2,5-6,10-11,15-16H,1,3-4,7-9,12-14H2,(H,20,24) |
| InChIKey | KZIOYIARSUXLFO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|