C15H18FN3O3S — CID 91770068
3-fluoro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 91770068) has the molecular formula C15H18FN3O3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-fluoro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91770068 |
| Molecular Formula | C15H18FN3O3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-fluoro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | Cn1cc(C(NS(=O)(=O)c2cccc(F)c2)C2CC(O)C2)cn1 |
| InChI | InChI=1S/C15H18FN3O3S/c1-19-9-11(8-17-19)15(10-5-13(20)6-10)18-23(21,22)14-4-2-3-12(16)7-14/h2-4,7-10,13,15,18,20H,5-6H2,1H3 |
| InChIKey | CIRDLPMGDAXJJD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |