C14H20N4O3 — CID 91771585
1-N'-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 91771585) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-N'-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 91771585 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-N'-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cn1cc(C(NC(=O)C2(C(N)=O)CC2)C2CC(O)C2)cn1 |
| InChI | InChI=1S/C14H20N4O3/c1-18-7-9(6-16-18)11(8-4-10(19)5-8)17-13(21)14(2-3-14)12(15)20/h6-8,10-11,19H,2-5H2,1H3,(H2,15,20)(H,17,21) |
| InChIKey | TZVIIMLZQFLGJD-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|