C15H25N5S — CID 91772177
4-(3-aminocyclobutyl)-6-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine (PubChem CID 91772177) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is 4-(3-aminocyclobutyl)-6-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-(3-aminocyclobutyl)-6-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91772177 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-(3-aminocyclobutyl)-6-[4-(methylsulfanylmethyl)piperidin-1-yl]pyrimidin-2-amine |
| SMILES | CSCC1CCN(c2cc(C3CC(N)C3)nc(N)n2)CC1 |
| InChI | InChI=1S/C15H25N5S/c1-21-9-10-2-4-20(5-3-10)14-8-13(18-15(17)19-14)11-6-12(16)7-11/h8,10-12H,2-7,9,16H2,1H3,(H2,17,18,19) |
| InChIKey | XFWKNUYIRBVNSM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |