C12H15N3O3 — CID 91772290
N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-methylfuran-3-carboxamide (PubChem CID 91772290) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 91772290 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-2-methylfuran-3-carboxamide |
| SMILES | COCc1cc(CNC(=O)c2ccoc2C)[nH]n1 |
| InChI | InChI=1S/C12H15N3O3/c1-8-11(3-4-18-8)12(16)13-6-9-5-10(7-17-2)15-14-9/h3-5H,6-7H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | XMPXUDZWENLXNA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |