C15H19ClN4O3 — CID 119073813
2-(2-aminoethoxy)-5-chloro-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]benzamide (PubChem CID 119073813) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-5-chloro-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]benzamide.
| Compound Name | 2-(2-aminoethoxy)-5-chloro-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 119073813 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-(2-aminoethoxy)-5-chloro-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]benzamide |
| SMILES | COCc1cc(CNC(=O)c2cc(Cl)ccc2OCCN)[nH]n1 |
| InChI | InChI=1S/C15H19ClN4O3/c1-22-9-12-7-11(19-20-12)8-18-15(21)13-6-10(16)2-3-14(13)23-5-4-17/h2-3,6-7H,4-5,8-9,17H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | RFKUCEGPTRLARO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |