C15H18FN3O3 — CID 91773799
4-fluoro-3-methoxy-N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]benzamide (PubChem CID 91773799) has the molecular formula C15H18FN3O3 and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]benzamide.
| Compound Name | 4-fluoro-3-methoxy-N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91773799 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-fluoro-3-methoxy-N-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]benzamide |
| SMILES | COCCn1cncc1CNC(=O)c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C15H18FN3O3/c1-21-6-5-19-10-17-8-12(19)9-18-15(20)11-3-4-13(16)14(7-11)22-2/h3-4,7-8,10H,5-6,9H2,1-2H3,(H,18,20) |
| InChIKey | ZSIGSFXXRIMLMZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |