C14H15N3O3 — CID 91775014
N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-oxo-2-phenylacetamide (PubChem CID 91775014) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-oxo-2-phenylacetamide.
| Compound Name | N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-oxo-2-phenylacetamide |
|---|---|
| PubChem CID | 91775014 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N-methyl-2-oxo-2-phenylacetamide |
| SMILES | CCc1nnc(CN(C)C(=O)C(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C14H15N3O3/c1-3-11-15-16-12(20-11)9-17(2)14(19)13(18)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3 |
| InChIKey | MFNYXDSNUWRJML-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|