C18H18ClN5O — CID 91777143
2-(4-chlorophenyl)-N-methyl-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]propanamide (PubChem CID 91777143) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-methyl-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]propanamide.
| Compound Name | 2-(4-chlorophenyl)-N-methyl-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 91777143 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N-methyl-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]propanamide |
| SMILES | CC(C(=O)N(C)Cc1cccc(-c2nn[nH]n2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN5O/c1-12(14-6-8-16(19)9-7-14)18(25)24(2)11-13-4-3-5-15(10-13)17-20-22-23-21-17/h3-10,12H,11H2,1-2H3,(H,20,21,22,23) |
| InChIKey | GIANJNSVZSBFAB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |