C15H15ClFN3O — CID 91777911
3-[6-[(3-chloro-2-fluorophenyl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91777911) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is 3-[6-[(3-chloro-2-fluorophenyl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol.
| Compound Name | 3-[6-[(3-chloro-2-fluorophenyl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 91777911 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-[6-[(3-chloro-2-fluorophenyl)methylamino]pyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | OC1CC(c2cc(NCc3cccc(Cl)c3F)ncn2)C1 |
| InChI | InChI=1S/C15H15ClFN3O/c16-12-3-1-2-9(15(12)17)7-18-14-6-13(19-8-20-14)10-4-11(21)5-10/h1-3,6,8,10-11,21H,4-5,7H2,(H,18,19,20) |
| InChIKey | PDWFMUCJLBXLRN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |