C18H25Cl3N4S — CID 154901870
6-(3-aminocyclobutyl)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]pyrimidin-4-amine;dihydrochloride (PubChem CID 154901870) has the molecular formula C18H25Cl3N4S and a molecular weight of 435.85 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]pyrimidin-4-amine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154901870 |
| Molecular Formula | C18H25Cl3N4S |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]pyrimidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC(c2cc(NCCCSCc3ccccc3Cl)ncn2)C1 |
| InChI | InChI=1S/C18H23ClN4S.2ClH/c19-16-5-2-1-4-13(16)11-24-7-3-6-21-18-10-17(22-12-23-18)14-8-15(20)9-14;;/h1-2,4-5,10,12,14-15H,3,6-9,11,20H2,(H,21,22,23);2*1H |
| InChIKey | CXQMNPISCHIFLW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|