C18H22ClN5 — CID 91770772
3-[6-[4-(2-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine (PubChem CID 91770772) has the molecular formula C18H22ClN5 and a molecular weight of 343.86 g/mol. Its IUPAC name is 3-[6-[4-(2-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine.
| Compound Name | 3-[6-[4-(2-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 91770772 |
| Molecular Formula | C18H22ClN5 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-[6-[4-(2-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine |
| SMILES | NC1CC(c2cc(N3CCN(c4ccccc4Cl)CC3)ncn2)C1 |
| InChI | InChI=1S/C18H22ClN5/c19-15-3-1-2-4-17(15)23-5-7-24(8-6-23)18-11-16(21-12-22-18)13-9-14(20)10-13/h1-4,11-14H,5-10,20H2 |
| InChIKey | FXJBEHQZYDUZAH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |