C18H30Cl2N4 — CID 154902759
3-[6-(2-azaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride (PubChem CID 154902759) has the molecular formula C18H30Cl2N4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-[6-(2-azaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride.
| Compound Name | 3-[6-(2-azaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 154902759 |
| Molecular Formula | C18H30Cl2N4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[6-(2-azaspiro[5.5]undecan-2-yl)pyrimidin-4-yl]cyclobutan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC(c2cc(N3CCCC4(CCCCC4)C3)ncn2)C1 |
| InChI | InChI=1S/C18H28N4.2ClH/c19-15-9-14(10-15)16-11-17(21-13-20-16)22-8-4-7-18(12-22)5-2-1-3-6-18;;/h11,13-15H,1-10,12,19H2;2*1H |
| InChIKey | OKTGDUXOJIKCHM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |